C12H23F3 — CID 23599860
1,1,1-trifluoro-4,4,6,6-tetramethyloctane (PubChem CID 23599860) has the molecular formula C12H23F3 and a molecular weight of 224.31 g/mol. Its IUPAC name is 1,1,1-trifluoro-4,4,6,6-tetramethyloctane.
| Compound Name | 1,1,1-trifluoro-4,4,6,6-tetramethyloctane |
|---|---|
| PubChem CID | 23599860 |
| Molecular Formula | C12H23F3 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1,1,1-trifluoro-4,4,6,6-tetramethyloctane |
| SMILES | CCC(C)(C)CC(C)(C)CCC(F)(F)F |
| InChI | InChI=1S/C12H23F3/c1-6-10(2,3)9-11(4,5)7-8-12(13,14)15/h6-9H2,1-5H3 |
| InChIKey | GAUQJOQWCNQKIQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |