C28H46O5 — CID 23599965
(2-cyclohexyloxy-2-oxoethyl) 7-hydroxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate (PubChem CID 23599965) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is (2-cyclohexyloxy-2-oxoethyl) 7-hydroxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | (2-cyclohexyloxy-2-oxoethyl) 7-hydroxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 23599965 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | (2-cyclohexyloxy-2-oxoethyl) 7-hydroxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
| SMILES | CC(C)C1(O)CCC2C(CCC3C(C)(C(=O)OCC(=O)OC4CCCCC4)CCCC23C)C1 |
| InChI | InChI=1S/C28H46O5/c1-19(2)28(31)16-13-22-20(17-28)11-12-23-26(22,3)14-8-15-27(23,4)25(30)32-18-24(29)33-21-9-6-5-7-10-21/h19-23,31H,5-18H2,1-4H3 |
| InChIKey | XDYXIAPEZSYZTK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |