C12H32O4Si3 — CID 23600195
2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethanol (PubChem CID 23600195) has the molecular formula C12H32O4Si3 and a molecular weight of 324.64 g/mol. Its IUPAC name is 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethanol.
| Compound Name | 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethanol |
|---|---|
| PubChem CID | 23600195 |
| Molecular Formula | C12H32O4Si3 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethanol |
| SMILES | C[Si](C)(C)O[Si](C)(CCCOCCO)O[Si](C)(C)C |
| InChI | InChI=1S/C12H32O4Si3/c1-17(2,3)15-19(7,16-18(4,5)6)12-8-10-14-11-9-13/h13H,8-12H2,1-7H3 |
| InChIKey | XPUVHEQXMIQSGY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|