About 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione
5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione (PubChem CID 23600274) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione.
Molecular Properties
| Compound Name | 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione |
| PubChem CID | 23600274 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione |
| SMILES | CC(C)c1oc(=O)n(C)c(=O)c1C(C)(C)C |
| InChI | InChI=1S/C12H19NO3/c1-7(2)9-8(12(3,4)5)10(14)13(6)11(15)16-9/h7H,1-6H3 |
| InChIKey | SHQZHDHBCLZBKN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione?
The IUPAC name of 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione (CID 23600274) is 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione.
What is the SMILES notation for 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione?
The canonical SMILES for 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione is CC(C)c1oc(=O)n(C)c(=O)c1C(C)(C)C.
What is the InChIKey of 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione?
The InChIKey is SHQZHDHBCLZBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3/c1-7(2)9-8(12(3,4)5)10(14)13(6)11(15)16-9/h7H,1-6H3.
What are the key properties of 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione?
5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione has a molecular weight of 225.29 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-methyl-6-propan-2-yl-1,3-oxazine-2,4-dione is sourced from PubChem (CID 23600274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).