C16H27NO8 — CID 23601239
tert-butyl (2S,4R)-2-[(R)-[(1S,2R,3S,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-hydroxymethyl]-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 23601239) has the molecular formula C16H27NO8 and a molecular weight of 361.39 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(R)-[(1S,2R,3S,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-hydroxymethyl]-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[(R)-[(1S,2R,3S,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-hydroxymethyl]-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23601239 |
| Molecular Formula | C16H27NO8 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(R)-[(1S,2R,3S,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-hydroxymethyl]-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)C[C@H]1[C@H](O)[C@H]1[C@@H](O)[C@@H]2CO[C@H](O2)[C@@H]1O |
| InChI | InChI=1S/C16H27NO8/c1-16(2,3)25-15(22)17-5-7(18)4-8(17)11(19)10-12(20)9-6-23-14(24-9)13(10)21/h7-14,18-21H,4-6H2,1-3H3/t7-,8+,9+,10+,11+,12+,13-,14-/m1/s1 |
| InChIKey | BDOMSBHOMYMDBZ-PFKAGXPPSA-N |
| XLogP | -1.19 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |