About 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide
3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide (PubChem CID 2360214) has the molecular formula C10H22N3O+
and a molecular weight of 200.31 g/mol. Its IUPAC name is 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide.
Molecular Properties
| Compound Name | 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide |
| PubChem CID | 2360214 |
| Molecular Formula | C10H22N3O+ |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide |
| SMILES | C[C@@H]1CCC[C@H](C)[NH+]1CCC(=O)NN |
| InChI | InChI=1S/C10H21N3O/c1-8-4-3-5-9(2)13(8)7-6-10(14)12-11/h8-9H,3-7,11H2,1-2H3,(H,12,14)/p+1/t8-,9+ |
| InChIKey | HLOUAWBRMBXWTR-DTORHVGOSA-O |
| XLogP | -0.79 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide?
The IUPAC name of 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide (CID 2360214) is 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide.
What is the SMILES notation for 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide?
The canonical SMILES for 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide is C[C@@H]1CCC[C@H](C)[NH+]1CCC(=O)NN.
What is the InChIKey of 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide?
The InChIKey is HLOUAWBRMBXWTR-DTORHVGOSA-O. The full InChI is InChI=1S/C10H21N3O/c1-8-4-3-5-9(2)13(8)7-6-10(14)12-11/h8-9H,3-7,11H2,1-2H3,(H,12,14)/p+1/t8-,9+.
What are the key properties of 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide?
3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide has a molecular weight of 200.31 g/mol, XLogP of -0.79, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R,6S)-2,6-dimethylpiperidin-1-ium-1-yl]propanehydrazide is sourced from PubChem (CID 2360214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).