About N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide
N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 23602383) has the molecular formula C18H11ClFNO3S2
and a molecular weight of 407.88 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
Molecular Properties
| Compound Name | N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| PubChem CID | 23602383 |
| Molecular Formula | C18H11ClFNO3S2 |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1cc2c(s1)-c1ccccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C18H11ClFNO3S2/c19-13-8-11(5-6-14(13)20)21-18(22)15-7-10-9-26(23,24)16-4-2-1-3-12(16)17(10)25-15/h1-8H,9H2,(H,21,22) |
| InChIKey | JZYNIAZBPAAQML-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
The IUPAC name of N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (CID 23602383) is N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
What is the SMILES notation for N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
The canonical SMILES for N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide is O=C(Nc1ccc(F)c(Cl)c1)c1cc2c(s1)-c1ccccc1S(=O)(=O)C2.
What is the InChIKey of N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
The InChIKey is JZYNIAZBPAAQML-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11ClFNO3S2/c19-13-8-11(5-6-14(13)20)21-18(22)15-7-10-9-26(23,24)16-4-2-1-3-12(16)17(10)25-15/h1-8H,9H2,(H,21,22).
What are the key properties of N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide has a molecular weight of 407.88 g/mol, XLogP of 4.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide is sourced from PubChem (CID 23602383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).