C20H17NO4S2 — CID 23602423
N-(2-ethoxyphenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 23602423) has the molecular formula C20H17NO4S2 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
| Compound Name | N-(2-ethoxyphenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
|---|---|
| PubChem CID | 23602423 |
| Molecular Formula | C20H17NO4S2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N-(2-ethoxyphenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1cc2c(s1)-c1ccccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C20H17NO4S2/c1-2-25-16-9-5-4-8-15(16)21-20(22)17-11-13-12-27(23,24)18-10-6-3-7-14(18)19(13)26-17/h3-11H,2,12H2,1H3,(H,21,22) |
| InChIKey | HAJNKHBXAPZMME-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |