C24H27N3OS — CID 23602580
(2-methylphenyl)-(2-phenyl-8-propan-2-yl-3-sulfanylidene-1,4,8-triazaspiro[4.5]dec-1-en-4-yl)methanone (PubChem CID 23602580) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is (2-methylphenyl)-(2-phenyl-8-propan-2-yl-3-sulfanylidene-1,4,8-triazaspiro[4.5]dec-1-en-4-yl)methanone.
| Compound Name | (2-methylphenyl)-(2-phenyl-8-propan-2-yl-3-sulfanylidene-1,4,8-triazaspiro[4.5]dec-1-en-4-yl)methanone |
|---|---|
| PubChem CID | 23602580 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (2-methylphenyl)-(2-phenyl-8-propan-2-yl-3-sulfanylidene-1,4,8-triazaspiro[4.5]dec-1-en-4-yl)methanone |
| SMILES | Cc1ccccc1C(=O)N1C(=S)C(c2ccccc2)=NC12CCN(C(C)C)CC2 |
| InChI | InChI=1S/C24H27N3OS/c1-17(2)26-15-13-24(14-16-26)25-21(19-10-5-4-6-11-19)23(29)27(24)22(28)20-12-8-7-9-18(20)3/h4-12,17H,13-16H2,1-3H3 |
| InChIKey | JXFFRXOTBSXWOC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|