C21H21N3O6S — CID 23603045
N-(4-acetylphenyl)-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonylpropanamide (PubChem CID 23603045) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is N-(4-acetylphenyl)-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonylpropanamide.
| Compound Name | N-(4-acetylphenyl)-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonylpropanamide |
|---|---|
| PubChem CID | 23603045 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-(4-acetylphenyl)-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonylpropanamide |
| SMILES | CC(=O)c1ccc(NC(=O)CCS(=O)(=O)c2ccc3c(c2)n(C)c(=O)c(=O)n3C)cc1 |
| InChI | InChI=1S/C21H21N3O6S/c1-13(25)14-4-6-15(7-5-14)22-19(26)10-11-31(29,30)16-8-9-17-18(12-16)24(3)21(28)20(27)23(17)2/h4-9,12H,10-11H2,1-3H3,(H,22,26) |
| InChIKey | KGKQBKWBPRVDCS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 124.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|