C20H21N3O6S — CID 23603056
3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-(4-methoxyphenyl)propanamide (PubChem CID 23603056) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is 3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-(4-methoxyphenyl)propanamide.
| Compound Name | 3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 23603056 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCS(=O)(=O)c2ccc3c(c2)n(C)c(=O)c(=O)n3C)cc1 |
| InChI | InChI=1S/C20H21N3O6S/c1-22-16-9-8-15(12-17(16)23(2)20(26)19(22)25)30(27,28)11-10-18(24)21-13-4-6-14(29-3)7-5-13/h4-9,12H,10-11H2,1-3H3,(H,21,24) |
| InChIKey | SUUAQSMINUTGJB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|