C20H20FN3O5S — CID 23603101
3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-[(4-fluorophenyl)methyl]propanamide (PubChem CID 23603101) has the molecular formula C20H20FN3O5S and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-[(4-fluorophenyl)methyl]propanamide.
| Compound Name | 3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-[(4-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 23603101 |
| Molecular Formula | C20H20FN3O5S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-[(4-fluorophenyl)methyl]propanamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(S(=O)(=O)CCC(=O)NCc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C20H20FN3O5S/c1-23-16-8-7-15(11-17(16)24(2)20(27)19(23)26)30(28,29)10-9-18(25)22-12-13-3-5-14(21)6-4-13/h3-8,11H,9-10,12H2,1-2H3,(H,22,25) |
| InChIKey | XWGJFORJNZVWEV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|