About N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide
N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide (PubChem CID 23603123) has the molecular formula C22H25N3O5S
and a molecular weight of 443.53 g/mol. Its IUPAC name is N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide.
Molecular Properties
| Compound Name | N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide |
| PubChem CID | 23603123 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CCS(=O)(=O)c1ccc2c(c1)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C22H25N3O5S/c1-4-25(15-16-8-6-5-7-9-16)20(26)12-13-31(29,30)17-10-11-18-19(14-17)24(3)22(28)21(27)23(18)2/h5-11,14H,4,12-13,15H2,1-3H3 |
| InChIKey | BENNWRWGROATPX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 98.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide?
The IUPAC name of N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide (CID 23603123) is N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide.
What is the SMILES notation for N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide?
The canonical SMILES for N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide is CCN(Cc1ccccc1)C(=O)CCS(=O)(=O)c1ccc2c(c1)n(C)c(=O)c(=O)n2C.
What is the InChIKey of N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide?
The InChIKey is BENNWRWGROATPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O5S/c1-4-25(15-16-8-6-5-7-9-16)20(26)12-13-31(29,30)17-10-11-18-19(14-17)24(3)22(28)21(27)23(18)2/h5-11,14H,4,12-13,15H2,1-3H3.
What are the key properties of N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide?
N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide has a molecular weight of 443.53 g/mol, XLogP of 1.45, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-ethylpropanamide is sourced from PubChem (CID 23603123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).