About ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate
ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate (PubChem CID 23603153) has the molecular formula C18H23N3O5S2
and a molecular weight of 425.53 g/mol. Its IUPAC name is ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate |
| PubChem CID | 23603153 |
| Molecular Formula | C18H23N3O5S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CNS(=O)(=O)c2ccc3nc(C)sc3c2)CC1 |
| InChI | InChI=1S/C18H23N3O5S2/c1-3-26-18(23)13-6-8-21(9-7-13)17(22)11-19-28(24,25)14-4-5-15-16(10-14)27-12(2)20-15/h4-5,10,13,19H,3,6-9,11H2,1-2H3 |
| InChIKey | UEGYRLXDVLVIRN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate (CID 23603153) is ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)CNS(=O)(=O)c2ccc3nc(C)sc3c2)CC1.
What is the InChIKey of ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate?
The InChIKey is UEGYRLXDVLVIRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O5S2/c1-3-26-18(23)13-6-8-21(9-7-13)17(22)11-19-28(24,25)14-4-5-15-16(10-14)27-12(2)20-15/h4-5,10,13,19H,3,6-9,11H2,1-2H3.
What are the key properties of ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate?
ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate has a molecular weight of 425.53 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetyl]piperidine-4-carboxylate is sourced from PubChem (CID 23603153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).