C21H19BrN2O2S — CID 23603267
2-[4-(4-bromophenyl)-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol (PubChem CID 23603267) has the molecular formula C21H19BrN2O2S and a molecular weight of 443.37 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol.
| Compound Name | 2-[4-(4-bromophenyl)-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol |
|---|---|
| PubChem CID | 23603267 |
| Molecular Formula | C21H19BrN2O2S |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-[4-(4-bromophenyl)-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol |
| SMILES | COc1cccc(C2CC(c3ccc(Br)cc3)=NC(c3cccs3)N2)c1O |
| InChI | InChI=1S/C21H19BrN2O2S/c1-26-18-5-2-4-15(20(18)25)17-12-16(13-7-9-14(22)10-8-13)23-21(24-17)19-6-3-11-27-19/h2-11,17,21,24-25H,12H2,1H3 |
| InChIKey | KXGWTCMRQLGIFB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|