C21H20N4O4S2 — CID 23603735
2-[(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-4-methoxyanilino)methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 23603735) has the molecular formula C21H20N4O4S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-4-methoxyanilino)methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-4-methoxyanilino)methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 23603735 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2-[(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-4-methoxyanilino)methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | COc1ccc(N(Cc2cc(=O)n3ccccc3n2)C2=NC3CS(=O)(=O)CC3S2)cc1 |
| InChI | InChI=1S/C21H20N4O4S2/c1-29-16-7-5-15(6-8-16)25(21-23-17-12-31(27,28)13-18(17)30-21)11-14-10-20(26)24-9-3-2-4-19(24)22-14/h2-10,17-18H,11-13H2,1H3 |
| InChIKey | AMTMYIZINFQXSC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 93.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |