C18H16ClFN2O2S2 — CID 23603786
N-[(2-chloro-4-fluorophenyl)methyl]-5,5-dioxo-N-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine (PubChem CID 23603786) has the molecular formula C18H16ClFN2O2S2 and a molecular weight of 410.92 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-5,5-dioxo-N-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-5,5-dioxo-N-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 23603786 |
| Molecular Formula | C18H16ClFN2O2S2 |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-5,5-dioxo-N-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
| SMILES | O=S1(=O)CC2N=C(N(Cc3ccc(F)cc3Cl)c3ccccc3)SC2C1 |
| InChI | InChI=1S/C18H16ClFN2O2S2/c19-15-8-13(20)7-6-12(15)9-22(14-4-2-1-3-5-14)18-21-16-10-26(23,24)11-17(16)25-18/h1-8,16-17H,9-11H2 |
| InChIKey | OYQKAWRZKAJTNF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |