C23H27N3O3S2 — CID 23603810
N-(3,4-dimethylphenyl)-2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-3,4-dimethylanilino)acetamide (PubChem CID 23603810) has the molecular formula C23H27N3O3S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-3,4-dimethylanilino)acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-3,4-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 23603810 |
| Molecular Formula | C23H27N3O3S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-3,4-dimethylanilino)acetamide |
| SMILES | Cc1ccc(NC(=O)CN(C2=NC3CS(=O)(=O)CC3S2)c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C23H27N3O3S2/c1-14-5-7-18(9-16(14)3)24-22(27)11-26(19-8-6-15(2)17(4)10-19)23-25-20-12-31(28,29)13-21(20)30-23/h5-10,20-21H,11-13H2,1-4H3,(H,24,27) |
| InChIKey | NUEYLTJRGCWHBA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |