About 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one
6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 23604338) has the molecular formula C24H24N4O4S
and a molecular weight of 464.55 g/mol. Its IUPAC name is 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 23604338 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | Cc1ccc(N2C(=O)c3cccnc3C2Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O4S/c1-17-4-8-19(9-5-17)28-23(22-21(24(28)29)3-2-12-25-22)26-18-6-10-20(11-7-18)33(30,31)27-13-15-32-16-14-27/h2-12,23,26H,13-16H2,1H3 |
| InChIKey | UTHZLDHSBYLODO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one (CID 23604338) is 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one is Cc1ccc(N2C(=O)c3cccnc3C2Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1.
What is the InChIKey of 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one?
The InChIKey is UTHZLDHSBYLODO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O4S/c1-17-4-8-19(9-5-17)28-23(22-21(24(28)29)3-2-12-25-22)26-18-6-10-20(11-7-18)33(30,31)27-13-15-32-16-14-27/h2-12,23,26H,13-16H2,1H3.
What are the key properties of 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one?
6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one has a molecular weight of 464.55 g/mol, XLogP of 3.18, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methylphenyl)-7-(4-morpholin-4-ylsulfonylanilino)-7H-pyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 23604338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).