About [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate (PubChem CID 2360457) has the molecular formula C14H15F2NO4S
and a molecular weight of 331.34 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate.
Molecular Properties
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate |
| PubChem CID | 2360457 |
| Molecular Formula | C14H15F2NO4S |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCC(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C14H15F2NO4S/c1-9(18)2-7-13(20)21-8-12(19)17-10-3-5-11(6-4-10)22-14(15)16/h3-6,14H,2,7-8H2,1H3,(H,17,19) |
| InChIKey | PJYGEDZOTPBYQG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate?
The IUPAC name of [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate (CID 2360457) is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate.
What is the SMILES notation for [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate?
The canonical SMILES for [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate is CC(=O)CCC(=O)OCC(=O)Nc1ccc(SC(F)F)cc1.
What is the InChIKey of [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate?
The InChIKey is PJYGEDZOTPBYQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2NO4S/c1-9(18)2-7-13(20)21-8-12(19)17-10-3-5-11(6-4-10)22-14(15)16/h3-6,14H,2,7-8H2,1H3,(H,17,19).
What are the key properties of [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate?
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate has a molecular weight of 331.34 g/mol, XLogP of 2.85, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-oxopentanoate is sourced from PubChem (CID 2360457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).