C13H8N4O2 — CID 23604810
7-methyl-2,6-dioxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile (PubChem CID 23604810) has the molecular formula C13H8N4O2 and a molecular weight of 252.23 g/mol. Its IUPAC name is 7-methyl-2,6-dioxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile.
| Compound Name | 7-methyl-2,6-dioxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile |
|---|---|
| PubChem CID | 23604810 |
| Molecular Formula | C13H8N4O2 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 7-methyl-2,6-dioxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile |
| SMILES | Cn1c(=O)c(C#N)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C13H8N4O2/c1-16-11-9(6-8(7-14)12(16)18)13(19)17-5-3-2-4-10(17)15-11/h2-6H,1H3 |
| InChIKey | JKAIPJLAXKKVOF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 80.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|