C16H16BrN3O4S2 — CID 23605126
dimethyl 4-(4-bromophenyl)-8,9-dimethyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate (PubChem CID 23605126) has the molecular formula C16H16BrN3O4S2 and a molecular weight of 458.36 g/mol. Its IUPAC name is dimethyl 4-(4-bromophenyl)-8,9-dimethyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate.
| Compound Name | dimethyl 4-(4-bromophenyl)-8,9-dimethyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 23605126 |
| Molecular Formula | C16H16BrN3O4S2 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | dimethyl 4-(4-bromophenyl)-8,9-dimethyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate |
| SMILES | COC(=O)C1=NN(c2ccc(Br)cc2)C2(S1)SC(C(=O)OC)=C(C)N2C |
| InChI | InChI=1S/C16H16BrN3O4S2/c1-9-12(14(21)23-3)25-16(19(9)2)20(11-7-5-10(17)6-8-11)18-13(26-16)15(22)24-4/h5-8H,1-4H3 |
| InChIKey | BLBGLJWIMWPSNM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |