C17H18ClN3O4S2 — CID 23605145
7-O-ethyl 2-O-methyl 4-(4-chlorophenyl)-8,9-dimethyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate (PubChem CID 23605145) has the molecular formula C17H18ClN3O4S2 and a molecular weight of 427.94 g/mol. Its IUPAC name is 7-O-ethyl 2-O-methyl 4-(4-chlorophenyl)-8,9-dimethyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate.
| Compound Name | 7-O-ethyl 2-O-methyl 4-(4-chlorophenyl)-8,9-dimethyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 23605145 |
| Molecular Formula | C17H18ClN3O4S2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 7-O-ethyl 2-O-methyl 4-(4-chlorophenyl)-8,9-dimethyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(C)C2(SC(C(=O)OC)=NN2c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C17H18ClN3O4S2/c1-5-25-15(22)13-10(2)20(3)17(26-13)21(12-8-6-11(18)7-9-12)19-14(27-17)16(23)24-4/h6-9H,5H2,1-4H3 |
| InChIKey | PMUZYDZJPYGJNG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |