C22H17N7O2S — CID 23605310
2-[4-[(3,4-dimethoxyphenyl)methyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1,3-benzothiazole (PubChem CID 23605310) has the molecular formula C22H17N7O2S and a molecular weight of 443.49 g/mol. Its IUPAC name is 2-[4-[(3,4-dimethoxyphenyl)methyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-[(3,4-dimethoxyphenyl)methyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 23605310 |
| Molecular Formula | C22H17N7O2S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-[4-[(3,4-dimethoxyphenyl)methyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1,3-benzothiazole |
| SMILES | COc1ccc(Cc2nc3c4cnn(-c5nc6ccccc6s5)c4ncn3n2)cc1OC |
| InChI | InChI=1S/C22H17N7O2S/c1-30-16-8-7-13(9-17(16)31-2)10-19-26-21-14-11-24-29(20(14)23-12-28(21)27-19)22-25-15-5-3-4-6-18(15)32-22/h3-9,11-12H,10H2,1-2H3 |
| InChIKey | SYZXLVXWVLLWMN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 92.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |