C20H19N3O4S2 — CID 2360544
4-[[2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]benzoic acid (PubChem CID 2360544) has the molecular formula C20H19N3O4S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 4-[[2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2360544 |
| Molecular Formula | C20H19N3O4S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 4-[[2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]benzoic acid |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(C(=O)O)cc2)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C20H19N3O4S2/c1-4-9-23-18(25)16-11(2)12(3)29-17(16)22-20(23)28-10-15(24)21-14-7-5-13(6-8-14)19(26)27/h4-8H,1,9-10H2,2-3H3,(H,21,24)(H,26,27) |
| InChIKey | BHDQVJAVPYWNJO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|