C17H16Cl2N6 — CID 23605662
5-[(2,4-dichlorophenyl)methyl]-7-(3,6-dihydro-2H-pyridin-1-yl)-3-methyltriazolo[4,5-d]pyrimidine (PubChem CID 23605662) has the molecular formula C17H16Cl2N6 and a molecular weight of 375.26 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)methyl]-7-(3,6-dihydro-2H-pyridin-1-yl)-3-methyltriazolo[4,5-d]pyrimidine.
| Compound Name | 5-[(2,4-dichlorophenyl)methyl]-7-(3,6-dihydro-2H-pyridin-1-yl)-3-methyltriazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 23605662 |
| Molecular Formula | C17H16Cl2N6 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)methyl]-7-(3,6-dihydro-2H-pyridin-1-yl)-3-methyltriazolo[4,5-d]pyrimidine |
| SMILES | Cn1nnc2c(N3CC=CCC3)nc(Cc3ccc(Cl)cc3Cl)nc21 |
| InChI | InChI=1S/C17H16Cl2N6/c1-24-16-15(22-23-24)17(25-7-3-2-4-8-25)21-14(20-16)9-11-5-6-12(18)10-13(11)19/h2-3,5-6,10H,4,7-9H2,1H3 |
| InChIKey | IMEMLBSPOGUWIH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|