C25H16N4O2S — CID 23606237
13-(furan-2-yl)-5-(3-methylphenyl)-11-phenyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 23606237) has the molecular formula C25H16N4O2S and a molecular weight of 436.50 g/mol. Its IUPAC name is 13-(furan-2-yl)-5-(3-methylphenyl)-11-phenyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 13-(furan-2-yl)-5-(3-methylphenyl)-11-phenyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 23606237 |
| Molecular Formula | C25H16N4O2S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 13-(furan-2-yl)-5-(3-methylphenyl)-11-phenyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | Cc1cccc(-n2nnc3c(sc4nc(-c5ccccc5)cc(-c5ccco5)c43)c2=O)c1 |
| InChI | InChI=1S/C25H16N4O2S/c1-15-7-5-10-17(13-15)29-25(30)23-22(27-28-29)21-18(20-11-6-12-31-20)14-19(26-24(21)32-23)16-8-3-2-4-9-16/h2-14H,1H3 |
| InChIKey | UZXVIIAQDROTQT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |