C24H20ClN3O2S — CID 23606567
N-(4-chlorophenyl)-2-(6-ethoxy-4-phenylquinazolin-2-yl)sulfanylacetamide (PubChem CID 23606567) has the molecular formula C24H20ClN3O2S and a molecular weight of 449.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(6-ethoxy-4-phenylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-(6-ethoxy-4-phenylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 23606567 |
| Molecular Formula | C24H20ClN3O2S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-(4-chlorophenyl)-2-(6-ethoxy-4-phenylquinazolin-2-yl)sulfanylacetamide |
| SMILES | CCOc1ccc2nc(SCC(=O)Nc3ccc(Cl)cc3)nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H20ClN3O2S/c1-2-30-19-12-13-21-20(14-19)23(16-6-4-3-5-7-16)28-24(27-21)31-15-22(29)26-18-10-8-17(25)9-11-18/h3-14H,2,15H2,1H3,(H,26,29) |
| InChIKey | JMRJNVHTANNUJQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |