C21H27ClN6O5 — CID 23607173
2-(2-chlorophenoxy)-N-[2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]ethyl]acetamide (PubChem CID 23607173) has the molecular formula C21H27ClN6O5 and a molecular weight of 478.94 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]ethyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]ethyl]acetamide |
|---|---|
| PubChem CID | 23607173 |
| Molecular Formula | C21H27ClN6O5 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]ethyl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)NCCOc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H27ClN6O5/c22-16-3-1-2-4-17(16)33-15-18(29)23-5-10-32-21-25-19(27-6-11-30-12-7-27)24-20(26-21)28-8-13-31-14-9-28/h1-4H,5-15H2,(H,23,29) |
| InChIKey | OMHINYNOEKMKMF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|