About 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea
1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea (PubChem CID 23607566) has the molecular formula C14H16N4O2
and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea.
Molecular Properties
| Compound Name | 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea |
| PubChem CID | 23607566 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea |
| SMILES | O=C(Nc1cnc2ccccn2c1=O)NC1CCCC1 |
| InChI | InChI=1S/C14H16N4O2/c19-13-11(9-15-12-7-3-4-8-18(12)13)17-14(20)16-10-5-1-2-6-10/h3-4,7-10H,1-2,5-6H2,(H2,16,17,20) |
| InChIKey | FAMMZMRAIGJTLN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea?
The IUPAC name of 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea (CID 23607566) is 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea.
What is the SMILES notation for 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea?
The canonical SMILES for 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea is O=C(Nc1cnc2ccccn2c1=O)NC1CCCC1.
What is the InChIKey of 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea?
The InChIKey is FAMMZMRAIGJTLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2/c19-13-11(9-15-12-7-3-4-8-18(12)13)17-14(20)16-10-5-1-2-6-10/h3-4,7-10H,1-2,5-6H2,(H2,16,17,20).
What are the key properties of 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea?
1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea has a molecular weight of 272.31 g/mol, XLogP of 1.76, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea is sourced from PubChem (CID 23607566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).