C21H22Cl2N4S — CID 2360844
5-(2,4-dichlorophenyl)-4-(2-methylphenyl)-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 2360844) has the molecular formula C21H22Cl2N4S and a molecular weight of 433.41 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-4-(2-methylphenyl)-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 5-(2,4-dichlorophenyl)-4-(2-methylphenyl)-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2360844 |
| Molecular Formula | C21H22Cl2N4S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-4-(2-methylphenyl)-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | Cc1ccccc1-n1c(-c2ccc(Cl)cc2Cl)nn(CN2CCCCC2)c1=S |
| InChI | InChI=1S/C21H22Cl2N4S/c1-15-7-3-4-8-19(15)27-20(17-10-9-16(22)13-18(17)23)24-26(21(27)28)14-25-11-5-2-6-12-25/h3-4,7-10,13H,2,5-6,11-12,14H2,1H3 |
| InChIKey | HSQXFPZTTYDVCE-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|