C13H16N2O3 — CID 2360896
2-[1-(2-hydroxyethyl)-3,5-dimethylpyrazol-4-yl]oxyphenol (PubChem CID 2360896) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[1-(2-hydroxyethyl)-3,5-dimethylpyrazol-4-yl]oxyphenol.
| Compound Name | 2-[1-(2-hydroxyethyl)-3,5-dimethylpyrazol-4-yl]oxyphenol |
|---|---|
| PubChem CID | 2360896 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[1-(2-hydroxyethyl)-3,5-dimethylpyrazol-4-yl]oxyphenol |
| SMILES | Cc1nn(CCO)c(C)c1Oc1ccccc1O |
| InChI | InChI=1S/C13H16N2O3/c1-9-13(10(2)15(14-9)7-8-16)18-12-6-4-3-5-11(12)17/h3-6,16-17H,7-8H2,1-2H3 |
| InChIKey | JXHJAKKUGWPHNV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |