About 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine
3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine (PubChem CID 23609044) has the molecular formula C15H12FN5O
and a molecular weight of 297.29 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine.
Molecular Properties
| Compound Name | 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine |
| PubChem CID | 23609044 |
| Molecular Formula | C15H12FN5O |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine |
| SMILES | C#CCOc1nnc(C)c2nnn(Cc3ccc(F)cc3)c12 |
| InChI | InChI=1S/C15H12FN5O/c1-3-8-22-15-14-13(10(2)17-19-15)18-20-21(14)9-11-4-6-12(16)7-5-11/h1,4-7H,8-9H2,2H3 |
| InChIKey | LCADHNREMDVYFR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine?
The IUPAC name of 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine (CID 23609044) is 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine.
What is the SMILES notation for 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine?
The canonical SMILES for 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine is C#CCOc1nnc(C)c2nnn(Cc3ccc(F)cc3)c12.
What is the InChIKey of 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine?
The InChIKey is LCADHNREMDVYFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN5O/c1-3-8-22-15-14-13(10(2)17-19-15)18-20-21(14)9-11-4-6-12(16)7-5-11/h1,4-7H,8-9H2,2H3.
What are the key properties of 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine?
3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine has a molecular weight of 297.29 g/mol, XLogP of 1.73, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-fluorophenyl)methyl]-7-methyl-4-prop-2-ynoxytriazolo[4,5-d]pyridazine is sourced from PubChem (CID 23609044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).