C12H15NO3S — CID 23612074
2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one (PubChem CID 23612074) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one.
| Compound Name | 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 23612074 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one |
| SMILES | CCCCN1CC(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C12H15NO3S/c1-2-3-8-13-9-11(14)10-6-4-5-7-12(10)17(13,15)16/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | SVGDGRBYMKXVBA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |