About 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one
2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one (PubChem CID 23612074) has the molecular formula C12H15NO3S
and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one.
Molecular Properties
| Compound Name | 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one |
| PubChem CID | 23612074 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one |
| SMILES | CCCCN1CC(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C12H15NO3S/c1-2-3-8-13-9-11(14)10-6-4-5-7-12(10)17(13,15)16/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | SVGDGRBYMKXVBA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one?
The IUPAC name of 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one (CID 23612074) is 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one.
What is the SMILES notation for 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one?
The canonical SMILES for 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one is CCCCN1CC(=O)c2ccccc2S1(=O)=O.
What is the InChIKey of 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one?
The InChIKey is SVGDGRBYMKXVBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3S/c1-2-3-8-13-9-11(14)10-6-4-5-7-12(10)17(13,15)16/h4-7H,2-3,8-9H2,1H3.
What are the key properties of 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one?
2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one has a molecular weight of 253.32 g/mol, XLogP of 1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one is sourced from PubChem (CID 23612074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).