C21H18N2O6S — CID 23612106
(2-benzyl-1,1-dioxo-1λ6,2-benzothiazin-4-yl) 2-(2,5-dioxopyrrolidin-1-yl)acetate (PubChem CID 23612106) has the molecular formula C21H18N2O6S and a molecular weight of 426.45 g/mol. Its IUPAC name is (2-benzyl-1,1-dioxo-1λ6,2-benzothiazin-4-yl) 2-(2,5-dioxopyrrolidin-1-yl)acetate.
| Compound Name | (2-benzyl-1,1-dioxo-1λ6,2-benzothiazin-4-yl) 2-(2,5-dioxopyrrolidin-1-yl)acetate |
|---|---|
| PubChem CID | 23612106 |
| Molecular Formula | C21H18N2O6S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (2-benzyl-1,1-dioxo-1λ6,2-benzothiazin-4-yl) 2-(2,5-dioxopyrrolidin-1-yl)acetate |
| SMILES | O=C(CN1C(=O)CCC1=O)OC1=CN(Cc2ccccc2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C21H18N2O6S/c24-19-10-11-20(25)23(19)14-21(26)29-17-13-22(12-15-6-2-1-3-7-15)30(27,28)18-9-5-4-8-16(17)18/h1-9,13H,10-12,14H2 |
| InChIKey | PDRUIEYWHRKPAG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|