About (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate
(1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate (PubChem CID 23612116) has the molecular formula C18H14BrNO4S
and a molecular weight of 420.28 g/mol. Its IUPAC name is (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate.
Molecular Properties
| Compound Name | (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate |
| PubChem CID | 23612116 |
| Molecular Formula | C18H14BrNO4S |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate |
| SMILES | C=CCN1C=C(OC(=O)c2ccc(Br)cc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C18H14BrNO4S/c1-2-11-20-12-16(15-5-3-4-6-17(15)25(20,22)23)24-18(21)13-7-9-14(19)10-8-13/h2-10,12H,1,11H2 |
| InChIKey | KZYGAUFDHSVVKQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate?
The IUPAC name of (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate (CID 23612116) is (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate.
What is the SMILES notation for (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate?
The canonical SMILES for (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate is C=CCN1C=C(OC(=O)c2ccc(Br)cc2)c2ccccc2S1(=O)=O.
What is the InChIKey of (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate?
The InChIKey is KZYGAUFDHSVVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrNO4S/c1-2-11-20-12-16(15-5-3-4-6-17(15)25(20,22)23)24-18(21)13-7-9-14(19)10-8-13/h2-10,12H,1,11H2.
What are the key properties of (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate?
(1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate has a molecular weight of 420.28 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-bromobenzoate is sourced from PubChem (CID 23612116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).