C27H29FN4O — CID 23612343
[(4aS,8aR)-2-phenylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(2-fluorophenyl)methanone (PubChem CID 23612343) has the molecular formula C27H29FN4O and a molecular weight of 444.55 g/mol. Its IUPAC name is [(4aS,8aR)-2-phenylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(4aS,8aR)-2-phenylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 23612343 |
| Molecular Formula | C27H29FN4O |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [(4aS,8aR)-2-phenylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1c2nc(-c3ccccc3)nn2C2(CCCCC2)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C27H29FN4O/c28-22-15-7-5-13-20(22)25(33)31-23-16-8-6-14-21(23)27(17-9-2-10-18-27)32-26(31)29-24(30-32)19-11-3-1-4-12-19/h1,3-5,7,11-13,15,21,23H,2,6,8-10,14,16-18H2/t21-,23+/m1/s1 |
| InChIKey | ZCQWJUGFSAQAQS-GGAORHGYSA-N |
| XLogP | 5.96 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |