C23H29FN4O — CID 23612403
[(4aS,8aR)-2-ethylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(4-fluorophenyl)methanone (PubChem CID 23612403) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is [(4aS,8aR)-2-ethylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(4aS,8aR)-2-ethylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 23612403 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | [(4aS,8aR)-2-ethylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(4-fluorophenyl)methanone |
| SMILES | CCc1nc2n(n1)C1(CCCCC1)[C@@H]1CCCC[C@@H]1N2C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H29FN4O/c1-2-20-25-22-27(21(29)16-10-12-17(24)13-11-16)19-9-5-4-8-18(19)23(28(22)26-20)14-6-3-7-15-23/h10-13,18-19H,2-9,14-15H2,1H3/t18-,19+/m1/s1 |
| InChIKey | DQWLTBZOPHCAAD-MOPGFXCFSA-N |
| XLogP | 4.86 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |