C24H31FN4O — CID 23612433
[(4aS,8aR)-2-propan-2-ylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(4-fluorophenyl)methanone (PubChem CID 23612433) has the molecular formula C24H31FN4O and a molecular weight of 410.54 g/mol. Its IUPAC name is [(4aS,8aR)-2-propan-2-ylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(4aS,8aR)-2-propan-2-ylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 23612433 |
| Molecular Formula | C24H31FN4O |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | [(4aS,8aR)-2-propan-2-ylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]-(4-fluorophenyl)methanone |
| SMILES | CC(C)c1nc2n(n1)C1(CCCCC1)[C@@H]1CCCC[C@@H]1N2C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H31FN4O/c1-16(2)21-26-23-28(22(30)17-10-12-18(25)13-11-17)20-9-5-4-8-19(20)24(29(23)27-21)14-6-3-7-15-24/h10-13,16,19-20H,3-9,14-15H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | AGCVBNHNDBBZDS-UXHICEINSA-N |
| XLogP | 5.42 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |