C14H30N2O — CID 23612492
N-[(2,2-dimethyloxan-4-yl)methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 23612492) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is N-[(2,2-dimethyloxan-4-yl)methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[(2,2-dimethyloxan-4-yl)methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 23612492 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | N-[(2,2-dimethyloxan-4-yl)methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C14H30N2O/c1-5-16(6-2)9-8-15-12-13-7-10-17-14(3,4)11-13/h13,15H,5-12H2,1-4H3 |
| InChIKey | ZWDUJENMFBYCGT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|