About [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate (PubChem CID 2361273) has the molecular formula C18H18N2O7
and a molecular weight of 374.35 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate.
Molecular Properties
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate |
| PubChem CID | 2361273 |
| Molecular Formula | C18H18N2O7 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)Cc2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H18N2O7/c1-25-15-8-7-13(10-16(15)26-2)19-17(21)11-27-18(22)9-12-5-3-4-6-14(12)20(23)24/h3-8,10H,9,11H2,1-2H3,(H,19,21) |
| InChIKey | ZBSDVRSLWIEBJY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate?
The IUPAC name of [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate (CID 2361273) is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate.
What is the SMILES notation for [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate?
The canonical SMILES for [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate is COc1ccc(NC(=O)COC(=O)Cc2ccccc2[N+](=O)[O-])cc1OC.
What is the InChIKey of [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate?
The InChIKey is ZBSDVRSLWIEBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O7/c1-25-15-8-7-13(10-16(15)26-2)19-17(21)11-27-18(22)9-12-5-3-4-6-14(12)20(23)24/h3-8,10H,9,11H2,1-2H3,(H,19,21).
What are the key properties of [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate?
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate has a molecular weight of 374.35 g/mol, XLogP of 2.34, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-nitrophenyl)acetate is sourced from PubChem (CID 2361273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).