C19H21N5O2 — CID 23612739
cyclopropyl-[5-[[4-(dimethylamino)phenyl]methylamino]-3-(furan-2-yl)-1,2,4-triazol-1-yl]methanone (PubChem CID 23612739) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is cyclopropyl-[5-[[4-(dimethylamino)phenyl]methylamino]-3-(furan-2-yl)-1,2,4-triazol-1-yl]methanone.
| Compound Name | cyclopropyl-[5-[[4-(dimethylamino)phenyl]methylamino]-3-(furan-2-yl)-1,2,4-triazol-1-yl]methanone |
|---|---|
| PubChem CID | 23612739 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | cyclopropyl-[5-[[4-(dimethylamino)phenyl]methylamino]-3-(furan-2-yl)-1,2,4-triazol-1-yl]methanone |
| SMILES | CN(C)c1ccc(CNc2nc(-c3ccco3)nn2C(=O)C2CC2)cc1 |
| InChI | InChI=1S/C19H21N5O2/c1-23(2)15-9-5-13(6-10-15)12-20-19-21-17(16-4-3-11-26-16)22-24(19)18(25)14-7-8-14/h3-6,9-11,14H,7-8,12H2,1-2H3,(H,20,21,22) |
| InChIKey | ALXSSQARZGKLBT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|