About [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate
[4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate (PubChem CID 23613378) has the molecular formula C20H18ClN3O4S
and a molecular weight of 431.90 g/mol. Its IUPAC name is [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate |
| PubChem CID | 23613378 |
| Molecular Formula | C20H18ClN3O4S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate |
| SMILES | CC(=O)NC1=NN(C(C)=O)C(c2ccc(OC(=O)c3ccc(C)cc3)c(Cl)c2)S1 |
| InChI | InChI=1S/C20H18ClN3O4S/c1-11-4-6-14(7-5-11)19(27)28-17-9-8-15(10-16(17)21)18-24(13(3)26)23-20(29-18)22-12(2)25/h4-10,18H,1-3H3,(H,22,23,25) |
| InChIKey | OYEUCPULHVEVMK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate?
The IUPAC name of [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate (CID 23613378) is [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate.
What is the SMILES notation for [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate?
The canonical SMILES for [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate is CC(=O)NC1=NN(C(C)=O)C(c2ccc(OC(=O)c3ccc(C)cc3)c(Cl)c2)S1.
What is the InChIKey of [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate?
The InChIKey is OYEUCPULHVEVMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClN3O4S/c1-11-4-6-14(7-5-11)19(27)28-17-9-8-15(10-16(17)21)18-24(13(3)26)23-20(29-18)22-12(2)25/h4-10,18H,1-3H3,(H,22,23,25).
What are the key properties of [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate?
[4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate has a molecular weight of 431.90 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)-2-chlorophenyl] 4-methylbenzoate is sourced from PubChem (CID 23613378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).