C28H23ClN4O3 — CID 23614098
17-(4-chlorophenyl)-9-(2-hydroxy-4-methylphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione (PubChem CID 23614098) has the molecular formula C28H23ClN4O3 and a molecular weight of 498.97 g/mol. Its IUPAC name is 17-(4-chlorophenyl)-9-(2-hydroxy-4-methylphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione.
| Compound Name | 17-(4-chlorophenyl)-9-(2-hydroxy-4-methylphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
|---|---|
| PubChem CID | 23614098 |
| Molecular Formula | C28H23ClN4O3 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 17-(4-chlorophenyl)-9-(2-hydroxy-4-methylphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
| SMILES | Cc1ccc(C2Nc3ccccc3-n3c(-c4ccc(Cl)cc4)c4c(=O)n(C)c(=O)n(C)c4c32)c(O)c1 |
| InChI | InChI=1S/C28H23ClN4O3/c1-15-8-13-18(21(34)14-15)23-26-25-22(27(35)32(3)28(36)31(25)2)24(16-9-11-17(29)12-10-16)33(26)20-7-5-4-6-19(20)30-23/h4-14,23,30,34H,1-3H3 |
| InChIKey | DKXZUAOBCCEPFG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|