C24H24N4O5 — CID 23614104
12,14-dimethyl-9-(2,4,5-trimethoxyphenyl)-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione (PubChem CID 23614104) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 12,14-dimethyl-9-(2,4,5-trimethoxyphenyl)-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione.
| Compound Name | 12,14-dimethyl-9-(2,4,5-trimethoxyphenyl)-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
|---|---|
| PubChem CID | 23614104 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 12,14-dimethyl-9-(2,4,5-trimethoxyphenyl)-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
| SMILES | COc1cc(OC)c(C2Nc3ccccc3-n3cc4c(=O)n(C)c(=O)n(C)c4c32)cc1OC |
| InChI | InChI=1S/C24H24N4O5/c1-26-21-14(23(29)27(2)24(26)30)12-28-16-9-7-6-8-15(16)25-20(22(21)28)13-10-18(32-4)19(33-5)11-17(13)31-3/h6-12,20,25H,1-5H3 |
| InChIKey | NRHDLNZJSUMJNH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |