C19H15F2NO3 — CID 23614321
2-[2-[2-(3,4-difluorophenyl)ethyl]-4-oxoquinolin-1-yl]acetic acid (PubChem CID 23614321) has the molecular formula C19H15F2NO3 and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-[2-[2-(3,4-difluorophenyl)ethyl]-4-oxoquinolin-1-yl]acetic acid.
| Compound Name | 2-[2-[2-(3,4-difluorophenyl)ethyl]-4-oxoquinolin-1-yl]acetic acid |
|---|---|
| PubChem CID | 23614321 |
| Molecular Formula | C19H15F2NO3 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-[2-[2-(3,4-difluorophenyl)ethyl]-4-oxoquinolin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(CCc2ccc(F)c(F)c2)cc(=O)c2ccccc21 |
| InChI | InChI=1S/C19H15F2NO3/c20-15-8-6-12(9-16(15)21)5-7-13-10-18(23)14-3-1-2-4-17(14)22(13)11-19(24)25/h1-4,6,8-10H,5,7,11H2,(H,24,25) |
| InChIKey | ZRNSWJPARHHPEY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |