About 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid
2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid (PubChem CID 23614328) has the molecular formula C18H12F3NO3S
and a molecular weight of 379.36 g/mol. Its IUPAC name is 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid |
| PubChem CID | 23614328 |
| Molecular Formula | C18H12F3NO3S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(SCc2cccc(F)c2F)cc(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C18H12F3NO3S/c19-11-4-5-12-14(6-11)22(8-17(24)25)16(7-15(12)23)26-9-10-2-1-3-13(20)18(10)21/h1-7H,8-9H2,(H,24,25) |
| InChIKey | SWIPKGCTUJYOSU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid?
The IUPAC name of 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid (CID 23614328) is 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid.
What is the SMILES notation for 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid?
The canonical SMILES for 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid is O=C(O)Cn1c(SCc2cccc(F)c2F)cc(=O)c2ccc(F)cc21.
What is the InChIKey of 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid?
The InChIKey is SWIPKGCTUJYOSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F3NO3S/c19-11-4-5-12-14(6-11)22(8-17(24)25)16(7-15(12)23)26-9-10-2-1-3-13(20)18(10)21/h1-7H,8-9H2,(H,24,25).
What are the key properties of 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid?
2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid has a molecular weight of 379.36 g/mol, XLogP of 3.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2,3-difluorophenyl)methylsulfanyl]-7-fluoro-4-oxoquinolin-1-yl]acetic acid is sourced from PubChem (CID 23614328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).