C20H17F2NO4S — CID 23614359
5-[anilino-[(2,3-difluorophenyl)methylsulfanyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 23614359) has the molecular formula C20H17F2NO4S and a molecular weight of 405.42 g/mol. Its IUPAC name is 5-[anilino-[(2,3-difluorophenyl)methylsulfanyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[anilino-[(2,3-difluorophenyl)methylsulfanyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 23614359 |
| Molecular Formula | C20H17F2NO4S |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 5-[anilino-[(2,3-difluorophenyl)methylsulfanyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C(Nc2ccccc2)SCc2cccc(F)c2F)C(=O)O1 |
| InChI | InChI=1S/C20H17F2NO4S/c1-20(2)26-18(24)15(19(25)27-20)17(23-13-8-4-3-5-9-13)28-11-12-7-6-10-14(21)16(12)22/h3-10,23H,11H2,1-2H3 |
| InChIKey | XBBHKROZUIQCGN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|