C19H20N2O4S2 — CID 2361462
1,3-benzothiazol-2-ylmethyl 3-(diethylsulfamoyl)benzoate (PubChem CID 2361462) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-(diethylsulfamoyl)benzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2361462 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)OCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H20N2O4S2/c1-3-21(4-2)27(23,24)15-9-7-8-14(12-15)19(22)25-13-18-20-16-10-5-6-11-17(16)26-18/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | JIFRGFMVLZEULU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |