About 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide
2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide (PubChem CID 2361470) has the molecular formula C16H15N3O4
and a molecular weight of 313.31 g/mol. Its IUPAC name is 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide |
| PubChem CID | 2361470 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)c1OC |
| InChI | InChI=1S/C16H15N3O4/c1-22-13-5-3-4-10(14(13)23-2)15(20)17-9-6-7-11-12(8-9)19-16(21)18-11/h3-8H,1-2H3,(H,17,20)(H2,18,19,21) |
| InChIKey | MBLOSRHRKRAHSU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide?
The IUPAC name of 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide (CID 2361470) is 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide.
What is the SMILES notation for 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide?
The canonical SMILES for 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide is COc1cccc(C(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)c1OC.
What is the InChIKey of 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide?
The InChIKey is MBLOSRHRKRAHSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O4/c1-22-13-5-3-4-10(14(13)23-2)15(20)17-9-6-7-11-12(8-9)19-16(21)18-11/h3-8H,1-2H3,(H,17,20)(H2,18,19,21).
What are the key properties of 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide?
2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide has a molecular weight of 313.31 g/mol, XLogP of 2.13, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide is sourced from PubChem (CID 2361470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).